Indian Plant Antiviral Compound Database (IMPAC)
| Indian Plant Antiviral Compound | Description |
|---|---|
| InAVPCDB Accession Number | AVD023 |
| Compound Name | Gallic acid |
| Phytochemical category | Phenol |
| PubChem Id | 370 |
| IUPAC Name | 3,4,5-trihydroxybenzoic acid |
| Molecular Formula | C7H6O5 |
| Canonical SMILES Notation | C1=C(C=C(C(=C1O)O)O)C(=O)O |
| Binomial Name | Terminalia chebula |
| Vernacular Names | Kadukkai/Karakkaya/Harad/Myrobalan |
| Plant Part | Fruit |
| Family | Combretaceae |
| Description | Herpes simplex type 1, Influenza virus, Parainfluenza type-3, and SARS-CoV-2. |
| Mechanism of action | It inhibits the viral replication by targeting proteases. |
| Molecular weight | 170.12 g/mol |
| XLOGP3 | 0.7 |
| Num. H-bond acceptors | 5 |
| Num. H-bond donors | 4 |
| Rotatable bonds | 1 |
| Topological polar surface area | 97.99 Ų |
| Bioavailability Score | 0.56 |
| Druglikeness | Yes |
| Lipinski | 0 violation |
| References | El-Toumy SA, Salib JY, El-Kashak WA, Marty C, Bedoux G, Bourgougnon N. Antiviral effect of polyphenol rich plant extracts on herpes simplex virus type 1. Food Science and Human Wellness. 2018 Mar 1;7(1):91-101. ?z?elik B, Kartal M, Orhan I. Cytotoxicity, antiviral and antimicrobial activities of alkaloids, flavonoids, and phenolic acids. Pharmaceutical biology. 2011 Apr 1;49(4):396-402. |
