Indian Plant Antiviral Compound Database (IMPAC)
| Indian Plant Antiviral Compound | Description |
|---|---|
| InAVPCDB Accession Number | AVD043 |
| Compound Name | Quinic acid |
| Phytochemical category | cyclic polyol |
| PubChem Id | 6508 |
| IUPAC Name | (3R,5R)-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid |
| Molecular Formula | C7H12O6 |
| Canonical SMILES Notation | C1C(C(C(CC1(C(=O)O)O)O)O)O |
| Binomial Name | Eucalyptus globulus |
| Vernacular Names | Karpura Maram/ Safeda/Eucalyptus tree |
| Plant Part | Leaf |
| Family | Myrtaceae |
| Description | Hepatitis B virus and HIV. |
| Mechanism of action | It inhibits the viral replication mechanism |
| Molecular weight | 192.17 g/mol |
| XLOGP3 | -2.37 |
| Num. H-bond acceptors | 6 |
| Num. H-bond donors | 5 |
| Rotatable bonds | 1 |
| Topological polar surface area | 118.22 Ų |
| Bioavailability Score | 0.56 |
| Druglikeness | Yes |
| Lipinski | 0 violation |
| References | Wang GF, Shi LP, Ren YD, Liu QF, Liu HF, Zhang RJ, Li Z, Zhu FH, He PL, Tang W, Tao PZ. Anti-hepatitis B virus activity of chlorogenic acid, quinic acid and caffeic acid in vivo and in vitro. Antiviral research. 2009 Aug 1;83(2):186-90. |
