Indian Plant Antiviral Compound Database (IMPAC)
| Indian Plant Antiviral Compound | Description |
|---|---|
| InAVPCDB Accession Number | AVD042 |
| Compound Name | Piperine |
| Phytochemical category | Alkaloid |
| PubChem Id | 638024 |
| IUPAC Name | (2E,4E)-5-(1,3-benzodioxol-5-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one |
| Molecular Formula | C17H19NO3 |
| Canonical SMILES Notation | C1CCN(CC1)C(=O)C=CC=CC2=CC3=C(C=C2)OCO3 |
| Binomial Name | Piper nigrum |
| Vernacular Names | Piperaceae |
| Plant Part | Fruit |
| Family | Piperaceae |
| Description | Hepatitis B virus, Dengue, Ebola, and SARS-CoV-2. |
| Mechanism of action | It could inhibit the viral replication by targetting methyltransferase, protease, and interferon inhibitory domain of the viral proteins. |
| Molecular weight | 285.34 g/mol |
| XLOGP3 | 3.46 |
| Num. H-bond acceptors | 3 |
| Num. H-bond donors | 0 |
| Rotatable bonds | 4 |
| Topological polar surface area | 38.77 Ų |
| Bioavailability Score | 0.55 |
| Druglikeness | Yes |
| Lipinski | 0 violation |
| References | Jiang ZY, Liu WF, Zhang XM, Luo J, Ma YB, Chen JJ. Anti-HBV active constituents from Piper longum. Bioorganic & medicinal chemistry letters. 2013 Apr 1;23(7):2123-7. Nag A, Chowdhury RR. Piperine, an alkaloid of black pepper seeds can effectively inhibit the antiviral enzymes of Dengue and Ebola viruses, an in silico molecular docking study. Virusdisease. 2020 Sep;31(3):308-15. |
