Indian Plant Antiviral Compound Database (IMPAC)
| Indian Plant Antiviral Compound | Description |
|---|---|
| InAVPCDB Accession Number | AVD037 |
| Compound Name | Myricetin |
| Phytochemical category | Polyphenolic Flavonoid |
| PubChem Id | 5281672 |
| IUPAC Name | 3,5,7-trihydroxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
| Molecular Formula | C15H10O8 |
| Canonical SMILES Notation | C1=C(C=C(C(=C1O)O)O)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O |
| Binomial Name | Cochlospermum religiosum |
| Vernacular Names | Kattuparutti/Konda gogu/Cempanni/Galgal/buttercup tree |
| Plant Part | Leaf |
| Family | Bixaceae |
| Description | Human immunodeficiency virus, Influenza, Human papillomaviruses, and SARS-CoV-2. |
| Mechanism of action | It inhibits the viral replication by targeting proteases and reverse transcriptase. |
| Molecular weight | 318.24 g/mol |
| XLOGP3 | 1.18 |
| Num. H-bond acceptors | 8 |
| Num. H-bond donors | 6 |
| Rotatable bonds | 1 |
| Topological polar surface area | 151.59 Ų |
| Bioavailability Score | 0.55 |
| Druglikeness | Yes |
| Lipinski | 1 violation |
| References | Pasetto S, Pardi V, Murata RM. Anti-HIV-1 activity of flavonoid myricetin on HIV-1 infection in a dual-chamber in vitro model. PLoS One. 2014 Dec 29;9(12):e115323. |
