Indian Plant Antiviral Compound Database (IMPAC)
| Indian Plant Antiviral Compound | Description |
|---|---|
| InAVPCDB Accession Number | AVD027 |
| Compound Name | Gingerenone A |
| Phytochemical category | Diarylheptanoid |
| PubChem Id | 5281775 |
| IUPAC Name | (E)-1,7-bis(4-hydroxy-3-methoxyphenyl)hept-4-en-3-one |
| Molecular Formula | C21H24O5 |
| Canonical SMILES Notation | COC1=C(C=CC(=C1)CCC=CC(=O)CCC2=CC(=C(C=C2)O)OC)O |
| Binomial Name | Zingiber officinale |
| Vernacular Names | Inji/Allam/Adhrak/Ginger |
| Plant Part | Rhizome |
| Family | Zingiberaceae |
| Description | Influenza viruses like H1N1, HN1, HN2 |
| Mechanism of action | It restricts IAV replication by inhibiting JAK2 activity |
| Molecular weight | 356.41 g/mol |
| XLOGP3 | 3.74 |
| Num. H-bond acceptors | 5 |
| Num. H-bond donors | 2 |
| Rotatable bonds | 9 |
| Topological polar surface area | 75.99 Ų |
| Bioavailability Score | 0.55 |
| Druglikeness | Yes |
| Lipinski | 0 violation |
| References | Wang J, Prinz RA, Liu X, Xu X. In vitro and in vivo antiviral activity of gingerenone A on influenza A virus is mediated by targeting janus kinase 2. Viruses. 2020 Oct;12(10):1141. Vincent S, Arokiyaraj S, Saravanan M, Dhanraj M. Molecular docking studies on the anti-viral effects of compounds from Kabasura Kudineer on SARS-CoV-2 3CLpro. Frontiers in molecular biosciences. 2020 Dec 23;7:434. |
