Indian Plant Antiviral Compound Database (IMPAC)
| Indian Plant Antiviral Compound | Description |
|---|---|
| InAVPCDB Accession Number | AVD017 |
| Compound Name | Ellagic acid |
| Phytochemical category | heterotetracyclic tannin |
| PubChem Id | 5281855 |
| IUPAC Name | 6,7,13,14-tetrahydroxy-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaene-3,10-dione |
| Molecular Formula | C14H6O8 |
| Canonical SMILES Notation | C1=C2C3=C(C(=C1O)O)OC(=O)C4=CC(=C(C(=C43)OC2=O)O)O |
| Binomial Name | Terminalia chebula |
| Vernacular Names | Kadukkai/Karakkaya/Harad/Myrobalan |
| Plant Part | Fruit |
| Family | Combretaceae |
| Description | Human rhinovirus, Human papilloma virus, Hepatitis B virus, and SARS-CoV-2. |
| Mechanism of action | It strongly inhibits the viral replication process by targetting the host cellular mechanism like increasing antioxidants. |
| Molecular weight | 302.19 g/mol |
| XLOGP3 | 1.1 |
| Num. H-bond acceptors | 8 |
| Num. H-bond donors | 4 |
| Rotatable bonds | 0 |
| Topological polar surface area | 141.34 Ų |
| Bioavailability Score | 0.55 |
| Druglikeness | Yes |
| Lipinski | 0 violation |
| References | Park SW, Kwon MJ, Yoo JY, Choi HJ, Ahn YJ. Antiviral activity and possible mode of action of ellagic acid identified in Lagerstroemia speciosa leaves toward human rhinoviruses. BMC complementary and alternative medicine. 2014 Dec;14(1):1-8. David AB, Diamant E, Dor E, Barnea A, Natan N, Levin L, Chapman S, Mimran LC, Epstein E, Zichel R, Torgeman A. Identification of SARS-CoV-2 Receptor Binding Inhibitors by In Vitro Screening of Drug Libraries. Molecules. 2021 Jan;26(11):3213. |
