Indian Plant Antiviral Compound Database (IMPAC)
| Indian Plant Antiviral Compound | Description |
|---|---|
| InAVPCDB Accession Number | AVD009 |
| Compound Name | Cordycepin |
| Phytochemical category | Purine nucleoside |
| PubChem Id | 6303 |
| IUPAC Name | (2R,3R,5S)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolan-3-ol |
| Molecular Formula | C10H13N5O3 |
| Canonical SMILES Notation | C1C(OC(C1O)N2C=NC3=C(N=CN=C32)N)CO |
| Binomial Name | Cordyceps militaris |
| Vernacular Names | Keeda jadi/Keera jhar/Caterpillar fungus |
| Plant Part | Mycelium |
| Family | Cordycipitaceae |
| Description | Dengue virus, HIV, Epstein?Barr virus, and SARS-CoV-2. |
| Mechanism of action | It interrupts viral RNA replication by inhibiting reverse transcriptase, and regulates cellular signalling pathway that modulate signal transduction related to viral infection. |
| Molecular weight | 251.24 g/mol |
| XLOGP3 | -0.61 |
| Num. H-bond acceptors | 6 |
| Num. H-bond donors | 3 |
| Rotatable bonds | 2 |
| Topological polar surface area | 119.31 Ų |
| Bioavailability Score | 0.55 |
| Druglikeness | Yes |
| Lipinski | 0 violation |
| References | Panya A, Songprakhon P, Panwong S, Jantakee K, Kaewkod T, Tragoolpua Y, Sawasdee N, Lee VS, Nimmanpipug P, Yenchitsomanus PT. Cordycepin Inhibits Virus Replication in Dengue Virus-Infected Vero Cells. Molecules. 2021 Jan;26(11):3118. |
