Indian Plant Antiviral Compound Database (IMPAC)
| Indian Plant Antiviral Compound | Description |
|---|---|
| InAVPCDB Accession Number | AVD011 |
| Compound Name | Chebulic acid |
| Phytochemical category | Phenol |
| PubChem Id | 71308174 |
| IUPAC Name | (2S)-2-[(3S,4S)-3-carboxy-5,6,7-trihydroxy-1-oxo-3,4-dihydroisochromen-4-yl]butanedioic acid |
| Molecular Formula | C14H12O11 |
| Canonical SMILES Notation | C1=C2C(=C(C(=C1O)O)O)C(C(OC2=O)C(=O)O)C(CC(=O)O)C(=O)O |
| Binomial Name | Terminalia chebula |
| Vernacular Names | Kadukkai/Karakkaya/Harad/Myrobalan |
| Plant Part | Fruit |
| Family | Combretaceae |
| Description | Herpes virus type 2, Influenza A virus, and SARS-CoV-2. |
| Mechanism of action | It inhibits neuraminidase-mediated viral release mechanism; inhibits viral attachment, penetration, post-infection viral replication. |
| Molecular weight | 356.24 g/mol |
| XLOGP3 | -0.81 |
| Num. H-bond acceptors | 11 |
| Num. H-bond donors | 6 |
| Rotatable bonds | 5 |
| Topological polar surface area | 198.89 Ų |
| Bioavailability Score | 0.11 |
| Druglikeness | No |
| Lipinski | 2 violations |
| References | Li P, Du R, Wang Y, Hou X, Wang L, Zhao X, Zhan P, Liu X, Rong L, Cui Q. Identification of chebulinic acid and chebulagic acid as novel influenza viral neuraminidase inhibitors. Frontiers in microbiology. 2020 Feb 28;11:182. Kesharwani A, Polachira SK, Nair R, Agarwal A, Mishra NN, Gupta SK. Anti-HSV-2 activity of Terminalia chebula Retz extract and its constituents, chebulagic and chebulinic acids. BMC complementary and alternative medicine. 2017 Dec;17(1):1-1. |
