Indian Plant Antiviral Compound Database (IMPAC)
| Indian Plant Antiviral Compound | Description |
|---|---|
| InAVPCDB Accession Number | AVD045 |
| Compound Name | Rosmarinic acid |
| Phytochemical category | Phenolic monoterpenoid |
| PubChem Id | 5281792 |
| IUPAC Name | (2R)-3-(3,4-dihydroxyphenyl)-2-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxypropanoic acid |
| Molecular Formula | C18H16O8 |
| Canonical SMILES Notation | C1=CC(=C(C=C1CC(C(=O)O)OC(=O)C=CC2=CC(=C(C=C2)O)O)O)O |
| Binomial Name | Mentha piperita |
| Vernacular Names | Pudina/Peppermint |
| Plant Part | Leaf |
| Family | Lamiaceae |
| Description | Hepatitis B virus and Human immunodeficiency virus. |
| Mechanism of action | It inhibits ?-Pol binding and viral replication. |
| Molecular weight | 360.31 g/mol |
| XLOGP3 | 2.36 |
| Num. H-bond acceptors | 8 |
| Num. H-bond donors | 5 |
| Rotatable bonds | 7 |
| Topological polar surface area | 144.52 Ų |
| Bioavailability Score | 0.56 |
| Druglikeness | Yes |
| Lipinski | 0 violation |
| References | Tsukamoto Y, Ikeda S, Uwai K, Taguchi R, Chayama K, Sakaguchi T, Narita R, Yao WL, Takeuchi F, Otakaki Y, Watashi K. Rosmarinic acid is a novel inhibitor for Hepatitis B virus replication targeting viral epsilon RNA-polymerase interaction. PLoS One. 2018 May 21;13(5):e0197664. |
