Indian Plant Antiviral Compound Database (IMPAC)
| Indian Plant Antiviral Compound | Description |
|---|---|
| InAVPCDB Accession Number | AVD031 |
| Compound Name | Kaempferol |
| Phytochemical category | Flavonoid |
| PubChem Id | 5280863 |
| IUPAC Name | 3,5,7-trihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
| Molecular Formula | C15H10O6 |
| Canonical SMILES Notation | C1=CC(=CC=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O)O |
| Binomial Name | Coccinia grandis |
| Vernacular Names | kovakkai/Dhondakai/Kunduru/Tindora/Ivy gourd |
| Plant Part | Fruit |
| Family | Cucurbitaceae |
| Description | Human cytomegalovirus, HIV, SARS-CoV-2, Japanese encephalitis virus, Dengue virus, and other Flaviviruses. |
| Mechanism of action | It disrupts HIV-1 replication in the early stages of infection; inhibits reverse transcriptase and proteases. |
| Molecular weight | 286.24 g/mol |
| XLOGP3 | 1.9 |
| Num. H-bond acceptors | 6 |
| Num. H-bond donors | 4 |
| Rotatable bonds | 1 |
| Topological polar surface area | 111.13 Ų |
| Bioavailability Score | 0.55 |
| Druglikeness | Yes |
| Lipinski | 0 violation |
| References | Behbahani M, Sayedipour S, Pourazar A, Shanehsazzadeh M. In vitro anti-HIV-1 activities of kaempferol and kaempferol-7-O-glucoside isolated from Securigera securidaca. Research in pharmaceutical sciences. 2014 Nov;9(6):463. |
