Indian Plant Antiviral Compound Database (IMPAC)
| Indian Plant Antiviral Compound | Description |
|---|---|
| InAVPCDB Accession Number | AVD029 |
| Compound Name | Hypericin |
| Phytochemical category | Anthraquinone |
| PubChem Id | 3663 |
| IUPAC Name | 9,11,13,16,18,20-hexahydroxy-5,24-dimethyloctacyclo[13.11.1.12,10.03,8.04,25.019,27.021,26.014,28]octacosa-1(26),2,4(25),5,8,10,12,14(28),15(27),16,18,20,23-tridecaene-7,22-dione |
| Molecular Formula | C30H16O8 |
| Canonical SMILES Notation | CC1=CC(=O)C2=C(C3=C(C=C(C4=C3C5=C2C1=C6C(=CC(=O)C7=C(C8=C(C=C(C4=C8C5=C67)O)O)O)C)O)O)O |
| Binomial Name | Hypericum perforatum |
| Vernacular Names | Vettai pakku/Basant/St. John's wort |
| Plant Part | Flower |
| Family | Hypericaceae? |
| Description | Infectious bronchitis virus, Murine cytomegalovirus, Sindbis virus, Human immunodeficiency virus type 1, and SARS-CoV-2. |
| Mechanism of action | It prevents the replication of encapsulated viruses probably due to inhibition of the assembly and shedding of virus particles in infected cells. |
| Molecular weight | 504.44 g/mol |
| XLOGP3 | 5.71 |
| Num. H-bond acceptors | 8 |
| Num. H-bond donors | 6 |
| Rotatable bonds | 0 |
| Topological polar surface area | 155.52 Ų |
| Bioavailability Score | 0.17 |
| Druglikeness | No |
| Lipinski | 2 violations |
| References | Hudson JB, Lopez-Bazzocchi I, Towers GH. Antiviral activities of hypericin. Antiviral research. 1991 Feb 1;15(2):101-12. Antiviral Activity Against Infectious Bronchitis Virus and Bioactive Components of Hypericum perforatum L. |
