Indian Plant Antiviral Compound Database (IMPAC)
| Indian Plant Antiviral Compound | Description |
|---|---|
| InAVPCDB Accession Number | AVD026 |
| Compound Name | Gingerol |
| Phytochemical category | Beta-hydroxy ketone |
| PubChem Id | 442793 |
| IUPAC Name | (5S)-5-hydroxy-1-(4-hydroxy-3-methoxyphenyl)decan-3-one |
| Molecular Formula | C17H26O4 |
| Canonical SMILES Notation | CCCCCC(CC(=O)CCC1=CC(=C(C=C1)O)OC)O |
| Binomial Name | Zingiber officinale |
| Vernacular Names | Inji/Allam/Adhrak/Ginger |
| Plant Part | Rhizome |
| Family | Zingiberaceae |
| Description | Chikungunya virus, Human respiratory syncytial virus, and SARS-CoV-2. |
| Mechanism of action | It inhibits the viral infection through suppression of viral replication. |
| Molecular weight | 294.39 g/mol |
| XLOGP3 | 2.76 |
| Num. H-bond acceptors | 4 |
| Num. H-bond donors | 2 |
| Rotatable bonds | 10 |
| Topological polar surface area | 66.76 Ų |
| Bioavailability Score | 0.55 |
| Druglikeness | Yes |
| Lipinski | 0 violation |
| References | Hayati RF, Better CD, Denis D, Komarudin AG, Bowolaksono A, Yohan B, Sasmono RT. [6]-Gingerol Inhibits Chikungunya Virus Infection by Suppressing Viral Replication. BioMed Research International. 2021 Mar 27;2021. San Chang J, Wang KC, Yeh CF, Shieh DE, Chiang LC. Fresh ginger (Zingiber officinale) has anti-viral activity against human respiratory syncytial virus in human respiratory tract cell lines. Journal of ethnopharmacology. 2013 Jan 9;145(1):146-51. |
