Indian Plant Antiviral Compound Database (IMPAC)
| Indian Plant Antiviral Compound | Description |
|---|---|
| InAVPCDB Accession Number | AVD022 |
| Compound Name | Ferulic acid |
| Phytochemical category | Polyphenol |
| PubChem Id | 445858 |
| IUPAC Name | (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid |
| Molecular Formula | C10H10O4 |
| Canonical SMILES Notation | COC1=C(C=CC(=C1)C=CC(=O)O)O |
| Binomial Name | Elephantopus scaber |
| Vernacular Names | Anashovadi/Samdudri/Enugabira/Elephant foot |
| Plant Part | Leaf |
| Family | Asteraceae |
| Description | Influenza A virus, Vesicular stomatitis virus, Herpes simplex virus, Coxsackie virus, Deline calicivirus, Murine norovirus-1, and Enterovirus -71. |
| Mechanism of action | It inhibits the growth by interrupting the replication process. |
| Molecular weight | 194.18 g/mol |
| XLOGP3 | 1.51 |
| Num. H-bond acceptors | 4 |
| Num. H-bond donors | 2 |
| Rotatable bonds | 3 |
| Topological polar surface area | 66.76 Ų |
| Bioavailability Score | 0.85 |
| Druglikeness | Yes |
| Lipinski | 0 violation |
| References | Takeda Y, Okuyama Y, Nakano H, Yaoita Y, Machida K, Ogawa H, Imai K. Antiviral activities of Hibiscus sabdariffa L. tea extract against human influenza A virus rely largely on acidic pH but partially on a low-pH-independent mechanism. Food and environmental virology. 2020 Mar;12(1):9-19. Weeratunga P, Uddin MB, Kim MS, Lee BH, Kim TH, Yoon JE, Ma JY, Kim H, Lee JS. Interferon-mediated antiviral activities of Angelica tenuissima Nakai and its active components (Retraction of Vol 54, Pg 57, 2016). |
