Indian Plant Antiviral Compound Database (IMPAC)
| Indian Plant Antiviral Compound | Description |
|---|---|
| InAVPCDB Accession Number | AVD014 |
| Compound Name | Curcumin |
| Phytochemical category | Polyphenol |
| PubChem Id | 969516 |
| IUPAC Name | (1E,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione |
| Molecular Formula | C21H20O6 |
| Canonical SMILES Notation | COC1=C(C=CC(=C1)C=CC(=O)CC(=O)C=CC2=CC(=C(C=C2)O)OC)O |
| Binomial Name | Curcuma longa |
| Vernacular Names | Manjal/Pasupu/Haldhi/Turmeric |
| Plant Part | Rhizome |
| Family | Zingiberaceae |
| Description | Human immuno deficiency, Herpes viruses, and SARS-CoV-2. |
| Mechanism of action | It restrains direct interaction with viral membrane proteins and disruption of the viral envelope; inhibits viral proteases; induces host antiviral responses; suppression of cellular signaling pathways essential for viral replication, such as PI3K/Akt, NF-?B. |
| Molecular weight | 368.38 g/mol |
| XLOGP3 | 3.2 |
| Num. H-bond acceptors | 6 |
| Num. H-bond donors | 2 |
| Rotatable bonds | 8 |
| Topological polar surface area | 93.06 Ų |
| Bioavailability Score | 0.55 |
| Druglikeness | Yes |
| Lipinski | 0 violation |
| References | Harikumar KB, Kuttan R. Antiviral activity of Phyllanthus amarus and curcumin. Amla Res Bull. 2006;26:198?205. Thimmulappa RK, Kumar MN, Shivamallu C, Subramaniam KT, Radhakrishnan A, Suresh B, Kuppusamy G. Antiviral and immunomodulatory activity of curcumin: A case for prophylactic therapy for COVID-19. Heliyon. 2021 Feb 22:e06350. |
