Indian Plant Antiviral Compound Database (IMPAC)
| Indian Plant Antiviral Compound | Description |
|---|---|
| InAVPCDB Accession Number | AVD004 |
| Compound Name | Apigenin |
| Phytochemical category | Trihydroxyflavone |
| PubChem Id | 5280443 |
| IUPAC Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
| Molecular Formula | C15H10O5 |
| Canonical SMILES Notation | C1=CC(=CC=C1C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O |
| Binomial Name | Ocimum sanctum |
| Vernacular Names | Thulasi/Tulsi/Holy Basil |
| Plant Part | Leaf |
| Family | Lamiaceae |
| Description | Enterovirus 71 (EV71), Buffalopox virus, and SARS-CoV-2. |
| Mechanism of action | It inhibits replication through suppressing viral internal ribosomal entry site activity and modulating cellular JNK pathway; inhibits polymerase activity and the synthesis of viral DNA. |
| Molecular weight | 270.24 g/mol |
| XLOGP3 | 3.02 |
| Num. H-bond acceptors | 5 |
| Num. H-bond donors | 3 |
| Rotatable bonds | 1 |
| Topological polar surface area | 90.90 Ų |
| Bioavailability Score | 0.55 |
| Druglikeness | Yes |
| Lipinski | 0 violation |
| References | Lv X, Qiu M, Chen D, Zheng N, Jin Y, Wu Z. Apigenin inhibits enterovirus 71 replication through suppressing viral IRES activity and modulating cellular JNK pathway. Antiviral research. 2014 Sep 1;109:30-41. Khandelwal N, Chander Y, Kumar R, Riyesh T, Dedar RK, Kumar M, Gulati BR, Sharma S, Tripathi BN, Barua S, Kumar N. Antiviral activity of Apigenin against buffalopox: Novel mechanistic insights and drug-resistance considerations. Antiviral Research. 2020 Sep 1;181:104870. |
